C50H58F3O8S2+ — CID 157454400
[4-(anthracen-9-ylmethoxy)phenyl]-bis[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;trifluoromethanesulfonic acid (PubChem CID 157454400) has the molecular formula C50H58F3O8S2+ and a molecular weight of 908.13 g/mol. Its IUPAC name is [4-(anthracen-9-ylmethoxy)phenyl]-bis[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;trifluoromethanesulfonic acid.
| Compound Name | [4-(anthracen-9-ylmethoxy)phenyl]-bis[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 157454400 |
| Molecular Formula | C50H58F3O8S2+ |
| Molecular Weight | 908.13 g/mol |
| Exact Mass | 907.35 |
| IUPAC Name | [4-(anthracen-9-ylmethoxy)phenyl]-bis[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;trifluoromethanesulfonic acid |
| SMILES | CC(C)(C)Oc1ccc([S+](c2ccc(OCc3c4ccccc4cc4ccccc34)cc2)c2ccc(OC(C)(C)C)c(OC(C)(C)C)c2)cc1OC(C)(C)C.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C49H57O5S.CHF3O3S/c1-46(2,3)51-42-27-25-37(30-44(42)53-48(7,8)9)55(38-26-28-43(52-47(4,5)6)45(31-38)54-49(10,11)12)36-23-21-35(22-24-36)50-32-41-39-19-15-13-17-33(39)29-34-18-14-16-20-40(34)41;2-1(3,4)8(5,6)7/h13-31H,32H2,1-12H3;(H,5,6,7)/q+1; |
| InChIKey | BTEHHEOHVNZNCC-UHFFFAOYSA-N |
| XLogP | 13.77 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.13 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|