C38H33F6O4S+ — CID 170523606
phenyl-bis[4-(2-phenylpropan-2-yloxy)-3-(trifluoromethoxy)phenyl]sulfanium (PubChem CID 170523606) has the molecular formula C38H33F6O4S+ and a molecular weight of 699.73 g/mol. Its IUPAC name is phenyl-bis[4-(2-phenylpropan-2-yloxy)-3-(trifluoromethoxy)phenyl]sulfanium.
| Compound Name | phenyl-bis[4-(2-phenylpropan-2-yloxy)-3-(trifluoromethoxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 170523606 |
| Molecular Formula | C38H33F6O4S+ |
| Molecular Weight | 699.73 g/mol |
| Exact Mass | 699.20 |
| IUPAC Name | phenyl-bis[4-(2-phenylpropan-2-yloxy)-3-(trifluoromethoxy)phenyl]sulfanium |
| SMILES | CC(C)(Oc1ccc([S+](c2ccccc2)c2ccc(OC(C)(C)c3ccccc3)c(OC(F)(F)F)c2)cc1OC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C38H33F6O4S/c1-35(2,26-14-8-5-9-15-26)45-31-22-20-29(24-33(31)47-37(39,40)41)49(28-18-12-7-13-19-28)30-21-23-32(34(25-30)48-38(42,43)44)46-36(3,4)27-16-10-6-11-17-27/h5-25H,1-4H3/q+1 |
| InChIKey | BKOOFTILKMHIGL-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.73 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|