C28H28FOS+ — CID 170523515
[3-(4-cyclopentyl-2-methylbut-3-yn-2-yl)oxy-4-fluorophenyl]-diphenylsulfanium (PubChem CID 170523515) has the molecular formula C28H28FOS+ and a molecular weight of 431.60 g/mol. Its IUPAC name is [3-(4-cyclopentyl-2-methylbut-3-yn-2-yl)oxy-4-fluorophenyl]-diphenylsulfanium.
| Compound Name | [3-(4-cyclopentyl-2-methylbut-3-yn-2-yl)oxy-4-fluorophenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 170523515 |
| Molecular Formula | C28H28FOS+ |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | [3-(4-cyclopentyl-2-methylbut-3-yn-2-yl)oxy-4-fluorophenyl]-diphenylsulfanium |
| SMILES | CC(C)(C#CC1CCCC1)Oc1cc([S+](c2ccccc2)c2ccccc2)ccc1F |
| InChI | InChI=1S/C28H28FOS/c1-28(2,20-19-22-11-9-10-12-22)30-27-21-25(17-18-26(27)29)31(23-13-5-3-6-14-23)24-15-7-4-8-16-24/h3-8,13-18,21-22H,9-12H2,1-2H3/q+1 |
| InChIKey | QZDBBBWQAHUZBZ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|