C24H23F3O3 — CID 177111714
phenyl 3-(4-cyclopentyl-2-methylbut-3-yn-2-yl)oxy-4-(trifluoromethyl)benzoate (PubChem CID 177111714) has the molecular formula C24H23F3O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is phenyl 3-(4-cyclopentyl-2-methylbut-3-yn-2-yl)oxy-4-(trifluoromethyl)benzoate.
| Compound Name | phenyl 3-(4-cyclopentyl-2-methylbut-3-yn-2-yl)oxy-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 177111714 |
| Molecular Formula | C24H23F3O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | phenyl 3-(4-cyclopentyl-2-methylbut-3-yn-2-yl)oxy-4-(trifluoromethyl)benzoate |
| SMILES | CC(C)(C#CC1CCCC1)Oc1cc(C(=O)Oc2ccccc2)ccc1C(F)(F)F |
| InChI | InChI=1S/C24H23F3O3/c1-23(2,15-14-17-8-6-7-9-17)30-21-16-18(12-13-20(21)24(25,26)27)22(28)29-19-10-4-3-5-11-19/h3-5,10-13,16-17H,6-9H2,1-2H3 |
| InChIKey | BULMUTPJXMGKIJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|