C27H29F3O3 — CID 177112139
phenyl 3-[2-(8-tricyclo[5.2.1.02,6]decanyl)propan-2-yloxy]-4-(trifluoromethyl)benzoate (PubChem CID 177112139) has the molecular formula C27H29F3O3 and a molecular weight of 458.52 g/mol. Its IUPAC name is phenyl 3-[2-(8-tricyclo[5.2.1.02,6]decanyl)propan-2-yloxy]-4-(trifluoromethyl)benzoate.
| Compound Name | phenyl 3-[2-(8-tricyclo[5.2.1.02,6]decanyl)propan-2-yloxy]-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 177112139 |
| Molecular Formula | C27H29F3O3 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | phenyl 3-[2-(8-tricyclo[5.2.1.02,6]decanyl)propan-2-yloxy]-4-(trifluoromethyl)benzoate |
| SMILES | CC(C)(Oc1cc(C(=O)Oc2ccccc2)ccc1C(F)(F)F)C1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C27H29F3O3/c1-26(2,23-14-17-13-21(23)20-10-6-9-19(17)20)33-24-15-16(11-12-22(24)27(28,29)30)25(31)32-18-7-4-3-5-8-18/h3-5,7-8,11-12,15,17,19-21,23H,6,9-10,13-14H2,1-2H3 |
| InChIKey | GSDMVJSSEDPXEJ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|