C26H25F3O4 — CID 177111243
phenyl 3-[(8-ethenyl-8-tricyclo[5.2.1.02,6]decanyl)oxy]-4-(trifluoromethoxy)benzoate (PubChem CID 177111243) has the molecular formula C26H25F3O4 and a molecular weight of 458.48 g/mol. Its IUPAC name is phenyl 3-[(8-ethenyl-8-tricyclo[5.2.1.02,6]decanyl)oxy]-4-(trifluoromethoxy)benzoate.
| Compound Name | phenyl 3-[(8-ethenyl-8-tricyclo[5.2.1.02,6]decanyl)oxy]-4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 177111243 |
| Molecular Formula | C26H25F3O4 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | phenyl 3-[(8-ethenyl-8-tricyclo[5.2.1.02,6]decanyl)oxy]-4-(trifluoromethoxy)benzoate |
| SMILES | C=CC1(Oc2cc(C(=O)Oc3ccccc3)ccc2OC(F)(F)F)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C26H25F3O4/c1-2-25(15-17-13-21(25)20-10-6-9-19(17)20)32-23-14-16(11-12-22(23)33-26(27,28)29)24(30)31-18-7-4-3-5-8-18/h2-5,7-8,11-12,14,17,19-21H,1,6,9-10,13,15H2 |
| InChIKey | NTMDFFFIYFRVRZ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|