C22H21FO3 — CID 177111795
phenyl 3-[(2-ethenyl-2-bicyclo[2.2.1]heptanyl)oxy]-4-fluorobenzoate (PubChem CID 177111795) has the molecular formula C22H21FO3 and a molecular weight of 352.41 g/mol. Its IUPAC name is phenyl 3-[(2-ethenyl-2-bicyclo[2.2.1]heptanyl)oxy]-4-fluorobenzoate.
| Compound Name | phenyl 3-[(2-ethenyl-2-bicyclo[2.2.1]heptanyl)oxy]-4-fluorobenzoate |
|---|---|
| PubChem CID | 177111795 |
| Molecular Formula | C22H21FO3 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | phenyl 3-[(2-ethenyl-2-bicyclo[2.2.1]heptanyl)oxy]-4-fluorobenzoate |
| SMILES | C=CC1(Oc2cc(C(=O)Oc3ccccc3)ccc2F)CC2CCC1C2 |
| InChI | InChI=1S/C22H21FO3/c1-2-22(14-15-8-10-17(22)12-15)26-20-13-16(9-11-19(20)23)21(24)25-18-6-4-3-5-7-18/h2-7,9,11,13,15,17H,1,8,10,12,14H2 |
| InChIKey | YGKZFEWJCYIQDW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|