C29H29F3O4 — CID 177111269
phenyl 3-[(4-prop-1-en-2-yl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-4-(trifluoromethoxy)benzoate (PubChem CID 177111269) has the molecular formula C29H29F3O4 and a molecular weight of 498.54 g/mol. Its IUPAC name is phenyl 3-[(4-prop-1-en-2-yl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-4-(trifluoromethoxy)benzoate.
| Compound Name | phenyl 3-[(4-prop-1-en-2-yl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 177111269 |
| Molecular Formula | C29H29F3O4 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | phenyl 3-[(4-prop-1-en-2-yl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-4-(trifluoromethoxy)benzoate |
| SMILES | C=C(C)C1(Oc2cc(C(=O)Oc3ccccc3)ccc2OC(F)(F)F)CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C29H29F3O4/c1-16(2)28(15-20-13-22(28)26-18-9-8-17(12-18)25(20)26)35-24-14-19(10-11-23(24)36-29(30,31)32)27(33)34-21-6-4-3-5-7-21/h3-7,10-11,14,17-18,20,22,25-26H,1,8-9,12-13,15H2,2H3 |
| InChIKey | ZDMNIFKIEATDJX-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|