C22H21F3O4 — CID 177111730
phenyl 3-(1-prop-1-en-2-ylcyclopentyl)oxy-4-(trifluoromethoxy)benzoate (PubChem CID 177111730) has the molecular formula C22H21F3O4 and a molecular weight of 406.40 g/mol. Its IUPAC name is phenyl 3-(1-prop-1-en-2-ylcyclopentyl)oxy-4-(trifluoromethoxy)benzoate.
| Compound Name | phenyl 3-(1-prop-1-en-2-ylcyclopentyl)oxy-4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 177111730 |
| Molecular Formula | C22H21F3O4 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | phenyl 3-(1-prop-1-en-2-ylcyclopentyl)oxy-4-(trifluoromethoxy)benzoate |
| SMILES | C=C(C)C1(Oc2cc(C(=O)Oc3ccccc3)ccc2OC(F)(F)F)CCCC1 |
| InChI | InChI=1S/C22H21F3O4/c1-15(2)21(12-6-7-13-21)28-19-14-16(10-11-18(19)29-22(23,24)25)20(26)27-17-8-4-3-5-9-17/h3-5,8-11,14H,1,6-7,12-13H2,2H3 |
| InChIKey | UIICWPALSLKYCS-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|