C22H19F3O5 — CID 177111561
phenyl 3-[(2-ethenyl-7-oxabicyclo[2.2.1]heptan-2-yl)oxy]-4-(trifluoromethoxy)benzoate (PubChem CID 177111561) has the molecular formula C22H19F3O5 and a molecular weight of 420.38 g/mol. Its IUPAC name is phenyl 3-[(2-ethenyl-7-oxabicyclo[2.2.1]heptan-2-yl)oxy]-4-(trifluoromethoxy)benzoate.
| Compound Name | phenyl 3-[(2-ethenyl-7-oxabicyclo[2.2.1]heptan-2-yl)oxy]-4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 177111561 |
| Molecular Formula | C22H19F3O5 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | phenyl 3-[(2-ethenyl-7-oxabicyclo[2.2.1]heptan-2-yl)oxy]-4-(trifluoromethoxy)benzoate |
| SMILES | C=CC1(Oc2cc(C(=O)Oc3ccccc3)ccc2OC(F)(F)F)CC2CCC1O2 |
| InChI | InChI=1S/C22H19F3O5/c1-2-21(13-16-9-11-19(21)27-16)29-18-12-14(8-10-17(18)30-22(23,24)25)20(26)28-15-6-4-3-5-7-15/h2-8,10,12,16,19H,1,9,11,13H2 |
| InChIKey | CEOJWCFRTWIGOZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|