C24H27F3O4 — CID 177111648
phenyl 3-(2-cyclohexylbutan-2-yloxy)-4-(trifluoromethoxy)benzoate (PubChem CID 177111648) has the molecular formula C24H27F3O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is phenyl 3-(2-cyclohexylbutan-2-yloxy)-4-(trifluoromethoxy)benzoate.
| Compound Name | phenyl 3-(2-cyclohexylbutan-2-yloxy)-4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 177111648 |
| Molecular Formula | C24H27F3O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | phenyl 3-(2-cyclohexylbutan-2-yloxy)-4-(trifluoromethoxy)benzoate |
| SMILES | CCC(C)(Oc1cc(C(=O)Oc2ccccc2)ccc1OC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C24H27F3O4/c1-3-23(2,18-10-6-4-7-11-18)30-21-16-17(14-15-20(21)31-24(25,26)27)22(28)29-19-12-8-5-9-13-19/h5,8-9,12-16,18H,3-4,6-7,10-11H2,1-2H3 |
| InChIKey | FFTKBSLEOKLUGR-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|