C15H15FO4 — CID 170685933
3-[(2-ethenyl-7-oxabicyclo[2.2.1]heptan-2-yl)oxy]-4-fluorobenzoic acid (PubChem CID 170685933) has the molecular formula C15H15FO4 and a molecular weight of 278.28 g/mol. Its IUPAC name is 3-[(2-ethenyl-7-oxabicyclo[2.2.1]heptan-2-yl)oxy]-4-fluorobenzoic acid.
| Compound Name | 3-[(2-ethenyl-7-oxabicyclo[2.2.1]heptan-2-yl)oxy]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 170685933 |
| Molecular Formula | C15H15FO4 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 3-[(2-ethenyl-7-oxabicyclo[2.2.1]heptan-2-yl)oxy]-4-fluorobenzoic acid |
| SMILES | C=CC1(Oc2cc(C(=O)O)ccc2F)CC2CCC1O2 |
| InChI | InChI=1S/C15H15FO4/c1-2-15(8-10-4-6-13(15)19-10)20-12-7-9(14(17)18)3-5-11(12)16/h2-3,5,7,10,13H,1,4,6,8H2,(H,17,18) |
| InChIKey | ZGQCARKVOXHYGW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|