C16H17FO3 — CID 170686279
4-fluoro-3-[(3E,5Z)-2-methylocta-3,5,7-trien-2-yl]oxybenzoic acid (PubChem CID 170686279) has the molecular formula C16H17FO3 and a molecular weight of 276.31 g/mol. Its IUPAC name is 4-fluoro-3-[(3E,5Z)-2-methylocta-3,5,7-trien-2-yl]oxybenzoic acid.
| Compound Name | 4-fluoro-3-[(3E,5Z)-2-methylocta-3,5,7-trien-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 170686279 |
| Molecular Formula | C16H17FO3 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 4-fluoro-3-[(3E,5Z)-2-methylocta-3,5,7-trien-2-yl]oxybenzoic acid |
| SMILES | C=C/C=C\C=C\C(C)(C)Oc1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C16H17FO3/c1-4-5-6-7-10-16(2,3)20-14-11-12(15(18)19)8-9-13(14)17/h4-11H,1H2,2-3H3,(H,18,19)/b6-5-,10-7+ |
| InChIKey | DIWWMFXUUZJEGU-ZZWPSLBBSA-N |
| XLogP | 3.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|