C15H19FN2O3 — CID 139517174
3-[(Z)-5-amino-4-ethanimidoylhex-4-enoxy]-4-fluorobenzoic acid (PubChem CID 139517174) has the molecular formula C15H19FN2O3 and a molecular weight of 294.33 g/mol. Its IUPAC name is 3-[(Z)-5-amino-4-ethanimidoylhex-4-enoxy]-4-fluorobenzoic acid.
| Compound Name | 3-[(Z)-5-amino-4-ethanimidoylhex-4-enoxy]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 139517174 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 3-[(Z)-5-amino-4-ethanimidoylhex-4-enoxy]-4-fluorobenzoic acid |
| SMILES | [H]/N=C(C)/C(CCCOc1cc(C(=O)O)ccc1F)=C(/C)N |
| InChI | InChI=1S/C15H19FN2O3/c1-9(17)12(10(2)18)4-3-7-21-14-8-11(15(19)20)5-6-13(14)16/h5-6,8,17H,3-4,7,18H2,1-2H3,(H,19,20)/b12-10-,17-9+ |
| InChIKey | JYMKWDKPCUHKGX-KDIGXJNUSA-N |
| XLogP | 2.96 |
| TPSA | 96.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|