C32H36F2N2O6 — CID 158631534
3-[3-(3,5-dimethyl-2H-pyrrol-4-yl)propoxy]-4-fluorobenzoic acid (PubChem CID 158631534) has the molecular formula C32H36F2N2O6 and a molecular weight of 582.64 g/mol. Its IUPAC name is 3-[3-(3,5-dimethyl-2H-pyrrol-4-yl)propoxy]-4-fluorobenzoic acid.
| Compound Name | 3-[3-(3,5-dimethyl-2H-pyrrol-4-yl)propoxy]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 158631534 |
| Molecular Formula | C32H36F2N2O6 |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | 3-[3-(3,5-dimethyl-2H-pyrrol-4-yl)propoxy]-4-fluorobenzoic acid |
| SMILES | CC1=NCC(C)=C1CCCOc1cc(C(=O)O)ccc1F.CC1=NCC(C)=C1CCCOc1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/2C16H18FNO3/c2*1-10-9-18-11(2)13(10)4-3-7-21-15-8-12(16(19)20)5-6-14(15)17/h2*5-6,8H,3-4,7,9H2,1-2H3,(H,19,20) |
| InChIKey | HZGITNZUDUDVSS-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|