C19H26FN3O3 — CID 167448397
2-(dimethylamino)ethyl 3-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propoxy]-4-fluorobenzoate (PubChem CID 167448397) has the molecular formula C19H26FN3O3 and a molecular weight of 363.43 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 3-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propoxy]-4-fluorobenzoate.
| Compound Name | 2-(dimethylamino)ethyl 3-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propoxy]-4-fluorobenzoate |
|---|---|
| PubChem CID | 167448397 |
| Molecular Formula | C19H26FN3O3 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 2-(dimethylamino)ethyl 3-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propoxy]-4-fluorobenzoate |
| SMILES | Cc1n[nH]c(C)c1CCCOc1cc(C(=O)OCCN(C)C)ccc1F |
| InChI | InChI=1S/C19H26FN3O3/c1-13-16(14(2)22-21-13)6-5-10-25-18-12-15(7-8-17(18)20)19(24)26-11-9-23(3)4/h7-8,12H,5-6,9-11H2,1-4H3,(H,21,22) |
| InChIKey | JMJVUILLPOQPMN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|