C17H21FN2O4 — CID 170372202
ethyl 4-fluoro-3-[3-[3-(hydroxymethyl)-5-methyl-1H-pyrazol-4-yl]propoxy]benzoate (PubChem CID 170372202) has the molecular formula C17H21FN2O4 and a molecular weight of 336.36 g/mol. Its IUPAC name is ethyl 4-fluoro-3-[3-[3-(hydroxymethyl)-5-methyl-1H-pyrazol-4-yl]propoxy]benzoate.
| Compound Name | ethyl 4-fluoro-3-[3-[3-(hydroxymethyl)-5-methyl-1H-pyrazol-4-yl]propoxy]benzoate |
|---|---|
| PubChem CID | 170372202 |
| Molecular Formula | C17H21FN2O4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | ethyl 4-fluoro-3-[3-[3-(hydroxymethyl)-5-methyl-1H-pyrazol-4-yl]propoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(F)c(OCCCc2c(CO)n[nH]c2C)c1 |
| InChI | InChI=1S/C17H21FN2O4/c1-3-23-17(22)12-6-7-14(18)16(9-12)24-8-4-5-13-11(2)19-20-15(13)10-21/h6-7,9,21H,3-5,8,10H2,1-2H3,(H,19,20) |
| InChIKey | YNPAQAHJMFYAKK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|