C26H40FN3O4Si — CID 159371340
ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-fluoro-7-[3-(hydroxymethyl)-5-methyl-1H-pyrazol-4-yl]-1H-indole-2-carboxylate;methane (PubChem CID 159371340) has the molecular formula C26H40FN3O4Si and a molecular weight of 505.71 g/mol. Its IUPAC name is ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-fluoro-7-[3-(hydroxymethyl)-5-methyl-1H-pyrazol-4-yl]-1H-indole-2-carboxylate;methane.
| Compound Name | ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-fluoro-7-[3-(hydroxymethyl)-5-methyl-1H-pyrazol-4-yl]-1H-indole-2-carboxylate;methane |
|---|---|
| PubChem CID | 159371340 |
| Molecular Formula | C26H40FN3O4Si |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-fluoro-7-[3-(hydroxymethyl)-5-methyl-1H-pyrazol-4-yl]-1H-indole-2-carboxylate;methane |
| SMILES | C.CCOC(=O)c1[nH]c2c(-c3c(CO)n[nH]c3C)c(F)ccc2c1CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H36FN3O4Si.CH4/c1-8-32-24(31)23-16(10-9-13-33-34(6,7)25(3,4)5)17-11-12-18(26)21(22(17)27-23)20-15(2)28-29-19(20)14-30;/h11-12,27,30H,8-10,13-14H2,1-7H3,(H,28,29);1H4 |
| InChIKey | LJTZLOQVCLXFIS-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|