C27H40FN3O4Si — CID 142591540
ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7-[5-ethyl-3-(hydroxymethyl)-1-methylpyrazol-4-yl]-6-fluoro-1H-indole-2-carboxylate (PubChem CID 142591540) has the molecular formula C27H40FN3O4Si and a molecular weight of 517.72 g/mol. Its IUPAC name is ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7-[5-ethyl-3-(hydroxymethyl)-1-methylpyrazol-4-yl]-6-fluoro-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7-[5-ethyl-3-(hydroxymethyl)-1-methylpyrazol-4-yl]-6-fluoro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 142591540 |
| Molecular Formula | C27H40FN3O4Si |
| Molecular Weight | 517.72 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7-[5-ethyl-3-(hydroxymethyl)-1-methylpyrazol-4-yl]-6-fluoro-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c(CO)nn(C)c3CC)c(F)ccc2c1CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H40FN3O4Si/c1-9-21-23(20(16-32)30-31(21)6)22-19(28)14-13-18-17(25(29-24(18)22)26(33)34-10-2)12-11-15-35-36(7,8)27(3,4)5/h13-14,29,32H,9-12,15-16H2,1-8H3 |
| InChIKey | NMKGDKIXVBQDJU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.72 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|