C27H43N3O4Si — CID 167602516
ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7-[3-ethyl-5-(hydroxymethyl)-1H-pyrazol-4-yl]-1H-indole-2-carboxylate;methane (PubChem CID 167602516) has the molecular formula C27H43N3O4Si and a molecular weight of 501.74 g/mol. Its IUPAC name is ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7-[3-ethyl-5-(hydroxymethyl)-1H-pyrazol-4-yl]-1H-indole-2-carboxylate;methane.
| Compound Name | ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7-[3-ethyl-5-(hydroxymethyl)-1H-pyrazol-4-yl]-1H-indole-2-carboxylate;methane |
|---|---|
| PubChem CID | 167602516 |
| Molecular Formula | C27H43N3O4Si |
| Molecular Weight | 501.74 g/mol |
| Exact Mass | 501.30 |
| IUPAC Name | ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7-[3-ethyl-5-(hydroxymethyl)-1H-pyrazol-4-yl]-1H-indole-2-carboxylate;methane |
| SMILES | C.CCOC(=O)c1[nH]c2c(-c3c(CC)n[nH]c3CO)cccc2c1CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H39N3O4Si.CH4/c1-8-20-22(21(16-30)29-28-20)19-13-10-12-17-18(24(27-23(17)19)25(31)32-9-2)14-11-15-33-34(6,7)26(3,4)5;/h10,12-13,27,30H,8-9,11,14-16H2,1-7H3,(H,28,29);1H4 |
| InChIKey | JXVFJGGPPVMXDW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.74 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|