C39H49ClFN3O5Si — CID 157346613
ethyl 7-[3-[3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-5-ethyl-1-methylpyrazol-4-yl]-6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1H-indole-2-carboxylate (PubChem CID 157346613) has the molecular formula C39H49ClFN3O5Si and a molecular weight of 722.37 g/mol. Its IUPAC name is ethyl 7-[3-[3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-5-ethyl-1-methylpyrazol-4-yl]-6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 7-[3-[3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-5-ethyl-1-methylpyrazol-4-yl]-6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 157346613 |
| Molecular Formula | C39H49ClFN3O5Si |
| Molecular Weight | 722.37 g/mol |
| Exact Mass | 721.31 |
| IUPAC Name | ethyl 7-[3-[3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-5-ethyl-1-methylpyrazol-4-yl]-6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c(C(O)CCO[Si](C)(C)C(C)(C)C)nn(C)c3CC)c(Cl)ccc2c1CCCOc1cccc2cc(F)ccc12 |
| InChI | InChI=1S/C39H49ClFN3O5Si/c1-9-30-34(37(43-44(30)6)31(45)20-22-49-50(7,8)39(3,4)5)33-29(40)19-18-28-27(36(42-35(28)33)38(46)47-10-2)14-12-21-48-32-15-11-13-24-23-25(41)16-17-26(24)32/h11,13,15-19,23,31,42,45H,9-10,12,14,20-22H2,1-8H3 |
| InChIKey | BHATXCZIFJZOAT-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.37 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|