C30H27ClF3N3O4 — CID 155123517
6-chloro-7-[5-ethyl-1-methyl-3-(2,2,2-trifluoro-1-hydroxyethyl)pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid (PubChem CID 155123517) has the molecular formula C30H27ClF3N3O4 and a molecular weight of 586.01 g/mol. Its IUPAC name is 6-chloro-7-[5-ethyl-1-methyl-3-(2,2,2-trifluoro-1-hydroxyethyl)pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid.
| Compound Name | 6-chloro-7-[5-ethyl-1-methyl-3-(2,2,2-trifluoro-1-hydroxyethyl)pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 155123517 |
| Molecular Formula | C30H27ClF3N3O4 |
| Molecular Weight | 586.01 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | 6-chloro-7-[5-ethyl-1-methyl-3-(2,2,2-trifluoro-1-hydroxyethyl)pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
| SMILES | CCc1c(-c2c(Cl)ccc3c(CCCOc4cccc5ccccc45)c(C(=O)O)[nH]c23)c(C(O)C(F)(F)F)nn1C |
| InChI | InChI=1S/C30H27ClF3N3O4/c1-3-21-24(27(36-37(21)2)28(38)30(32,33)34)23-20(31)14-13-19-18(26(29(39)40)35-25(19)23)11-7-15-41-22-12-6-9-16-8-4-5-10-17(16)22/h4-6,8-10,12-14,28,35,38H,3,7,11,15H2,1-2H3,(H,39,40) |
| InChIKey | ODZUZVHICGLZEQ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.01 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|