C29H22ClNO5 — CID 25144329
7-(5-carboxy-2-chlorophenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid (PubChem CID 25144329) has the molecular formula C29H22ClNO5 and a molecular weight of 499.95 g/mol. Its IUPAC name is 7-(5-carboxy-2-chlorophenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid.
| Compound Name | 7-(5-carboxy-2-chlorophenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 25144329 |
| Molecular Formula | C29H22ClNO5 |
| Molecular Weight | 499.95 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 7-(5-carboxy-2-chlorophenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cl)c(-c2cccc3c(CCCOc4cccc5ccccc45)c(C(=O)O)[nH]c23)c1 |
| InChI | InChI=1S/C29H22ClNO5/c30-24-14-13-18(28(32)33)16-23(24)22-10-4-9-20-21(27(29(34)35)31-26(20)22)11-5-15-36-25-12-3-7-17-6-1-2-8-19(17)25/h1-4,6-10,12-14,16,31H,5,11,15H2,(H,32,33)(H,34,35) |
| InChIKey | HUBJRUDJLHRPHI-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.95 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|