C38H36N2O4 — CID 68941084
7-[5-methyl-2-(4-phenylbutoxy)-4-pyridinyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid (PubChem CID 68941084) has the molecular formula C38H36N2O4 and a molecular weight of 584.72 g/mol. Its IUPAC name is 7-[5-methyl-2-(4-phenylbutoxy)-4-pyridinyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid.
| Compound Name | 7-[5-methyl-2-(4-phenylbutoxy)-4-pyridinyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68941084 |
| Molecular Formula | C38H36N2O4 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | 7-[5-methyl-2-(4-phenylbutoxy)-4-pyridinyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
| SMILES | Cc1cnc(OCCCCc2ccccc2)cc1-c1cccc2c(CCCOc3cccc4ccccc34)c(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C38H36N2O4/c1-26-25-39-35(44-22-8-7-14-27-12-3-2-4-13-27)24-33(26)32-19-10-18-30-31(37(38(41)42)40-36(30)32)20-11-23-43-34-21-9-16-28-15-5-6-17-29(28)34/h2-6,9-10,12-13,15-19,21,24-25,40H,7-8,11,14,20,22-23H2,1H3,(H,41,42) |
| InChIKey | LQWMBLAHJJQQSM-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|