C34H28N2O3 — CID 68936564
7-(4-methyl-2-phenyl-3-pyridinyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid (PubChem CID 68936564) has the molecular formula C34H28N2O3 and a molecular weight of 512.61 g/mol. Its IUPAC name is 7-(4-methyl-2-phenyl-3-pyridinyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid.
| Compound Name | 7-(4-methyl-2-phenyl-3-pyridinyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68936564 |
| Molecular Formula | C34H28N2O3 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 7-(4-methyl-2-phenyl-3-pyridinyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
| SMILES | Cc1ccnc(-c2ccccc2)c1-c1cccc2c(CCCOc3cccc4ccccc34)c(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C34H28N2O3/c1-22-19-20-35-31(24-11-3-2-4-12-24)30(22)28-16-8-15-26-27(33(34(37)38)36-32(26)28)17-9-21-39-29-18-7-13-23-10-5-6-14-25(23)29/h2-8,10-16,18-20,36H,9,17,21H2,1H3,(H,37,38) |
| InChIKey | PMQWSKCMARDOJZ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|