C30H27NO4 — CID 68936409
7-(2-methoxy-5-methylphenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid (PubChem CID 68936409) has the molecular formula C30H27NO4 and a molecular weight of 465.55 g/mol. Its IUPAC name is 7-(2-methoxy-5-methylphenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid.
| Compound Name | 7-(2-methoxy-5-methylphenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68936409 |
| Molecular Formula | C30H27NO4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 7-(2-methoxy-5-methylphenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
| SMILES | COc1ccc(C)cc1-c1cccc2c(CCCOc3cccc4ccccc34)c(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C30H27NO4/c1-19-15-16-26(34-2)25(18-19)24-12-6-11-22-23(29(30(32)33)31-28(22)24)13-7-17-35-27-14-5-9-20-8-3-4-10-21(20)27/h3-6,8-12,14-16,18,31H,7,13,17H2,1-2H3,(H,32,33) |
| InChIKey | HSVJHYXLIBARDS-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|