C35H35NO3 — CID 68939529
7-(2-cyclohexyl-6-methylphenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid (PubChem CID 68939529) has the molecular formula C35H35NO3 and a molecular weight of 517.67 g/mol. Its IUPAC name is 7-(2-cyclohexyl-6-methylphenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid.
| Compound Name | 7-(2-cyclohexyl-6-methylphenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68939529 |
| Molecular Formula | C35H35NO3 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | 7-(2-cyclohexyl-6-methylphenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
| SMILES | Cc1cccc(C2CCCCC2)c1-c1cccc2c(CCCOc3cccc4ccccc34)c(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C35H35NO3/c1-23-11-7-17-27(25-12-3-2-4-13-25)32(23)30-19-9-18-28-29(34(35(37)38)36-33(28)30)20-10-22-39-31-21-8-15-24-14-5-6-16-26(24)31/h5-9,11,14-19,21,25,36H,2-4,10,12-13,20,22H2,1H3,(H,37,38) |
| InChIKey | WKXSKKPHSOXXEQ-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|