C36H32N2O4 — CID 68937466
7-[5-methyl-2-(2-phenylethoxy)-4-pyridinyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid (PubChem CID 68937466) has the molecular formula C36H32N2O4 and a molecular weight of 556.66 g/mol. Its IUPAC name is 7-[5-methyl-2-(2-phenylethoxy)-4-pyridinyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid.
| Compound Name | 7-[5-methyl-2-(2-phenylethoxy)-4-pyridinyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68937466 |
| Molecular Formula | C36H32N2O4 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | 7-[5-methyl-2-(2-phenylethoxy)-4-pyridinyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
| SMILES | Cc1cnc(OCCc2ccccc2)cc1-c1cccc2c(CCCOc3cccc4ccccc34)c(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C36H32N2O4/c1-24-23-37-33(42-21-19-25-10-3-2-4-11-25)22-31(24)30-16-8-15-28-29(35(36(39)40)38-34(28)30)17-9-20-41-32-18-7-13-26-12-5-6-14-27(26)32/h2-8,10-16,18,22-23,38H,9,17,19-21H2,1H3,(H,39,40) |
| InChIKey | WNVPUZZWXMFOGP-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|