C26H25NO4 — CID 68936192
3-[3-(3-hydroxy-2-methylphenoxy)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid (PubChem CID 68936192) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 3-[3-(3-hydroxy-2-methylphenoxy)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid.
| Compound Name | 3-[3-(3-hydroxy-2-methylphenoxy)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68936192 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 3-[3-(3-hydroxy-2-methylphenoxy)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid |
| SMILES | Cc1ccccc1-c1cccc2c(CCCOc3cccc(O)c3C)c(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C26H25NO4/c1-16-8-3-4-9-18(16)19-10-5-11-20-21(25(26(29)30)27-24(19)20)12-7-15-31-23-14-6-13-22(28)17(23)2/h3-6,8-11,13-14,27-28H,7,12,15H2,1-2H3,(H,29,30) |
| InChIKey | QNURLOBGZHJCBX-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|