C30H27NO2 — CID 68937222
7-(2-methylphenyl)-3-(4-naphthalen-1-ylbutyl)-1H-indole-2-carboxylic acid (PubChem CID 68937222) has the molecular formula C30H27NO2 and a molecular weight of 433.55 g/mol. Its IUPAC name is 7-(2-methylphenyl)-3-(4-naphthalen-1-ylbutyl)-1H-indole-2-carboxylic acid.
| Compound Name | 7-(2-methylphenyl)-3-(4-naphthalen-1-ylbutyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68937222 |
| Molecular Formula | C30H27NO2 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 7-(2-methylphenyl)-3-(4-naphthalen-1-ylbutyl)-1H-indole-2-carboxylic acid |
| SMILES | Cc1ccccc1-c1cccc2c(CCCCc3cccc4ccccc34)c(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C30H27NO2/c1-20-10-2-5-15-23(20)25-18-9-19-26-27(29(30(32)33)31-28(25)26)17-7-4-12-22-14-8-13-21-11-3-6-16-24(21)22/h2-3,5-6,8-11,13-16,18-19,31H,4,7,12,17H2,1H3,(H,32,33) |
| InChIKey | WWQQFRHNJIQIJV-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|