C17H14N2O4 — CID 73010358
5-(2-naphthalen-1-ylethyl)-2,4-dioxo-1H-pyrimidine-6-carboxylic acid (PubChem CID 73010358) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 5-(2-naphthalen-1-ylethyl)-2,4-dioxo-1H-pyrimidine-6-carboxylic acid.
| Compound Name | 5-(2-naphthalen-1-ylethyl)-2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 73010358 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 5-(2-naphthalen-1-ylethyl)-2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
| SMILES | O=C(O)c1[nH]c(=O)[nH]c(=O)c1CCc1cccc2ccccc12 |
| InChI | InChI=1S/C17H14N2O4/c20-15-13(14(16(21)22)18-17(23)19-15)9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7H,8-9H2,(H,21,22)(H2,18,19,20,23) |
| InChIKey | SLNOQVWHLSWYRT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |