About 1-(3,3-dichloropropyl)naphthalene
1-(3,3-dichloropropyl)naphthalene (PubChem CID 54458566) has the molecular formula C13H12Cl2
and a molecular weight of 239.15 g/mol. Its IUPAC name is 1-(3,3-dichloropropyl)naphthalene.
Molecular Properties
| Compound Name | 1-(3,3-dichloropropyl)naphthalene |
| PubChem CID | 54458566 |
| Molecular Formula | C13H12Cl2 |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 1-(3,3-dichloropropyl)naphthalene |
| SMILES | ClC(Cl)CCc1cccc2ccccc12 |
| InChI | InChI=1S/C13H12Cl2/c14-13(15)9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7,13H,8-9H2 |
| InChIKey | WZYPVEUASSKKTG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-dichloropropyl)naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dichloropropyl)naphthalene?
The IUPAC name of 1-(3,3-dichloropropyl)naphthalene (CID 54458566) is 1-(3,3-dichloropropyl)naphthalene.
What is the SMILES notation for 1-(3,3-dichloropropyl)naphthalene?
The canonical SMILES for 1-(3,3-dichloropropyl)naphthalene is ClC(Cl)CCc1cccc2ccccc12.
What is the InChIKey of 1-(3,3-dichloropropyl)naphthalene?
The InChIKey is WZYPVEUASSKKTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2/c14-13(15)9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7,13H,8-9H2.
What are the key properties of 1-(3,3-dichloropropyl)naphthalene?
1-(3,3-dichloropropyl)naphthalene has a molecular weight of 239.15 g/mol, XLogP of 4.58, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dichloropropyl)naphthalene is sourced from PubChem (CID 54458566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).