C27H27NO4 — CID 130274454
[3-[3-(2,3-dimethylphenoxy)propyl]-7-(2-methylphenyl)-1H-indol-2-yl] hydrogen carbonate (PubChem CID 130274454) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is [3-[3-(2,3-dimethylphenoxy)propyl]-7-(2-methylphenyl)-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [3-[3-(2,3-dimethylphenoxy)propyl]-7-(2-methylphenyl)-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 130274454 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [3-[3-(2,3-dimethylphenoxy)propyl]-7-(2-methylphenyl)-1H-indol-2-yl] hydrogen carbonate |
| SMILES | Cc1ccccc1-c1cccc2c(CCCOc3cccc(C)c3C)c(OC(=O)O)[nH]c12 |
| InChI | InChI=1S/C27H27NO4/c1-17-10-6-15-24(19(17)3)31-16-8-14-23-22-13-7-12-21(20-11-5-4-9-18(20)2)25(22)28-26(23)32-27(29)30/h4-7,9-13,15,28H,8,14,16H2,1-3H3,(H,29,30) |
| InChIKey | UBSDYBFBQZXDEI-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|