C29H25NO4 — CID 130275595
[7-(4-methylphenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate (PubChem CID 130275595) has the molecular formula C29H25NO4 and a molecular weight of 451.52 g/mol. Its IUPAC name is [7-(4-methylphenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [7-(4-methylphenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 130275595 |
| Molecular Formula | C29H25NO4 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | [7-(4-methylphenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
| SMILES | Cc1ccc(-c2cccc3c(CCCOc4cccc5ccccc45)c(OC(=O)O)[nH]c23)cc1 |
| InChI | InChI=1S/C29H25NO4/c1-19-14-16-21(17-15-19)23-10-5-11-24-25(28(30-27(23)24)34-29(31)32)12-6-18-33-26-13-4-8-20-7-2-3-9-22(20)26/h2-5,7-11,13-17,30H,6,12,18H2,1H3,(H,31,32) |
| InChIKey | FWVSICDZPUHQAM-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|