C28H23ClN2O4 — CID 130275525
[7-(2-chloro-4-methyl-3-pyridinyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate (PubChem CID 130275525) has the molecular formula C28H23ClN2O4 and a molecular weight of 486.96 g/mol. Its IUPAC name is [7-(2-chloro-4-methyl-3-pyridinyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [7-(2-chloro-4-methyl-3-pyridinyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 130275525 |
| Molecular Formula | C28H23ClN2O4 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | [7-(2-chloro-4-methyl-3-pyridinyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
| SMILES | Cc1ccnc(Cl)c1-c1cccc2c(CCCOc3cccc4ccccc34)c(OC(=O)O)[nH]c12 |
| InChI | InChI=1S/C28H23ClN2O4/c1-17-14-15-30-26(29)24(17)22-11-5-10-20-21(27(31-25(20)22)35-28(32)33)12-6-16-34-23-13-4-8-18-7-2-3-9-19(18)23/h2-5,7-11,13-15,31H,6,12,16H2,1H3,(H,32,33) |
| InChIKey | VMWPQPHSXTXOSA-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|