C34H35N3O6 — CID 130274447
[7-[4-methyl-2-(2-morpholin-4-ylethoxy)-3-pyridinyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate (PubChem CID 130274447) has the molecular formula C34H35N3O6 and a molecular weight of 581.67 g/mol. Its IUPAC name is [7-[4-methyl-2-(2-morpholin-4-ylethoxy)-3-pyridinyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [7-[4-methyl-2-(2-morpholin-4-ylethoxy)-3-pyridinyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 130274447 |
| Molecular Formula | C34H35N3O6 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | [7-[4-methyl-2-(2-morpholin-4-ylethoxy)-3-pyridinyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
| SMILES | Cc1ccnc(OCCN2CCOCC2)c1-c1cccc2c(CCCOc3cccc4ccccc34)c(OC(=O)O)[nH]c12 |
| InChI | InChI=1S/C34H35N3O6/c1-23-14-15-35-33(42-22-18-37-16-20-40-21-17-37)30(23)28-11-5-10-26-27(32(36-31(26)28)43-34(38)39)12-6-19-41-29-13-4-8-24-7-2-3-9-25(24)29/h2-5,7-11,13-15,36H,6,12,16-22H2,1H3,(H,38,39) |
| InChIKey | IEMZMVYWPIEYER-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|