C37H29NO6 — CID 130274327
[7-(4-methoxy-2-phenyl-1-benzofuran-3-yl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate (PubChem CID 130274327) has the molecular formula C37H29NO6 and a molecular weight of 583.64 g/mol. Its IUPAC name is [7-(4-methoxy-2-phenyl-1-benzofuran-3-yl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [7-(4-methoxy-2-phenyl-1-benzofuran-3-yl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 130274327 |
| Molecular Formula | C37H29NO6 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | [7-(4-methoxy-2-phenyl-1-benzofuran-3-yl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
| SMILES | COc1cccc2oc(-c3ccccc3)c(-c3cccc4c(CCCOc5cccc6ccccc56)c(OC(=O)O)[nH]c34)c12 |
| InChI | InChI=1S/C37H29NO6/c1-41-30-20-9-21-31-33(30)32(35(43-31)24-12-3-2-4-13-24)28-17-8-16-26-27(36(38-34(26)28)44-37(39)40)18-10-22-42-29-19-7-14-23-11-5-6-15-25(23)29/h2-9,11-17,19-21,38H,10,18,22H2,1H3,(H,39,40) |
| InChIKey | OZYMGBPAQYPGOM-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 93.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|