C28H27NO4 — CID 130273936
[7-(cyclohexen-1-yl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate (PubChem CID 130273936) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is [7-(cyclohexen-1-yl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [7-(cyclohexen-1-yl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 130273936 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | [7-(cyclohexen-1-yl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1[nH]c2c(C3=CCCCC3)cccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C28H27NO4/c30-28(31)33-27-24(16-8-18-32-25-17-6-12-19-11-4-5-13-21(19)25)23-15-7-14-22(26(23)29-27)20-9-2-1-3-10-20/h4-7,9,11-15,17,29H,1-3,8,10,16,18H2,(H,30,31) |
| InChIKey | DGSVIGUHPUMQAD-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|