C28H21ClFNO4 — CID 130273988
[7-(3-chloro-2-fluorophenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate (PubChem CID 130273988) has the molecular formula C28H21ClFNO4 and a molecular weight of 489.93 g/mol. Its IUPAC name is [7-(3-chloro-2-fluorophenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [7-(3-chloro-2-fluorophenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 130273988 |
| Molecular Formula | C28H21ClFNO4 |
| Molecular Weight | 489.93 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | [7-(3-chloro-2-fluorophenyl)-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1[nH]c2c(-c3cccc(Cl)c3F)cccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C28H21ClFNO4/c29-23-14-5-10-19(25(23)30)20-11-4-12-21-22(27(31-26(20)21)35-28(32)33)13-6-16-34-24-15-3-8-17-7-1-2-9-18(17)24/h1-5,7-12,14-15,31H,6,13,16H2,(H,32,33) |
| InChIKey | XTBHSQIQJFGUIR-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.93 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|