C29H18F7NO4 — CID 130275679
[3-[3-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)oxypropyl]-7-(2-methylphenyl)-1H-indol-2-yl] hydrogen carbonate (PubChem CID 130275679) has the molecular formula C29H18F7NO4 and a molecular weight of 577.45 g/mol. Its IUPAC name is [3-[3-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)oxypropyl]-7-(2-methylphenyl)-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [3-[3-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)oxypropyl]-7-(2-methylphenyl)-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 130275679 |
| Molecular Formula | C29H18F7NO4 |
| Molecular Weight | 577.45 g/mol |
| Exact Mass | 577.11 |
| IUPAC Name | [3-[3-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)oxypropyl]-7-(2-methylphenyl)-1H-indol-2-yl] hydrogen carbonate |
| SMILES | Cc1ccccc1-c1cccc2c(CCCOc3c(F)c(F)c(F)c4c(F)c(F)c(F)c(F)c34)c(OC(=O)O)[nH]c12 |
| InChI | InChI=1S/C29H18F7NO4/c1-12-6-2-3-7-13(12)14-8-4-9-15-16(28(37-26(14)15)41-29(38)39)10-5-11-40-27-18-17(20(31)24(35)25(27)36)19(30)22(33)23(34)21(18)32/h2-4,6-9,37H,5,10-11H2,1H3,(H,38,39) |
| InChIKey | SDEQPQLZLVHLHQ-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.45 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|