C28H26FN3O4 — CID 130274338
[3-[3-(5-fluoronaphthalen-1-yl)oxypropyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indol-2-yl] hydrogen carbonate (PubChem CID 130274338) has the molecular formula C28H26FN3O4 and a molecular weight of 487.53 g/mol. Its IUPAC name is [3-[3-(5-fluoronaphthalen-1-yl)oxypropyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [3-[3-(5-fluoronaphthalen-1-yl)oxypropyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 130274338 |
| Molecular Formula | C28H26FN3O4 |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | [3-[3-(5-fluoronaphthalen-1-yl)oxypropyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indol-2-yl] hydrogen carbonate |
| SMILES | Cc1nn(C)c(C)c1-c1cccc2c(CCCOc3cccc4c(F)cccc34)c(OC(=O)O)[nH]c12 |
| InChI | InChI=1S/C28H26FN3O4/c1-16-25(17(2)32(3)31-16)22-11-4-10-20-21(27(30-26(20)22)36-28(33)34)12-7-15-35-24-14-6-8-18-19(24)9-5-13-23(18)29/h4-6,8-11,13-14,30H,7,12,15H2,1-3H3,(H,33,34) |
| InChIKey | ODKKZNYKXINHIT-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|