C34H41F2N3O3 — CID 166152664
ethane;ethyl 6-fluoro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxylate (PubChem CID 166152664) has the molecular formula C34H41F2N3O3 and a molecular weight of 577.72 g/mol. Its IUPAC name is ethane;ethyl 6-fluoro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxylate.
| Compound Name | ethane;ethyl 6-fluoro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 166152664 |
| Molecular Formula | C34H41F2N3O3 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | ethane;ethyl 6-fluoro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxylate |
| SMILES | CC.CC.CCOC(=O)c1[nH]c2c(-c3c(C)nn(C)c3C)c(F)ccc2c1CCCOc1cccc2cc(F)ccc12 |
| InChI | InChI=1S/C30H29F2N3O3.2C2H6/c1-5-37-30(36)29-22(9-7-15-38-25-10-6-8-19-16-20(31)11-12-21(19)25)23-13-14-24(32)27(28(23)33-29)26-17(2)34-35(4)18(26)3;2*1-2/h6,8,10-14,16,33H,5,7,9,15H2,1-4H3;2*1-2H3 |
| InChIKey | FLOBYHZJHXGYHT-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|