C31H37N3O3 — CID 167248219
ethyl 6-methyl-3-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxylate (PubChem CID 167248219) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is ethyl 6-methyl-3-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 6-methyl-3-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 167248219 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | ethyl 6-methyl-3-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c(C)nn(C)c3C)c(C)ccc2c1CCCOc1cccc2c1CCCC2 |
| InChI | InChI=1S/C31H37N3O3/c1-6-36-31(35)30-24(14-10-18-37-26-15-9-12-22-11-7-8-13-23(22)26)25-17-16-19(2)27(29(25)32-30)28-20(3)33-34(5)21(28)4/h9,12,15-17,32H,6-8,10-11,13-14,18H2,1-5H3 |
| InChIKey | NUHZAQLEZMUGIA-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|