C36H41N3O4 — CID 166022491
ethyl 7-[3-[(E)-6-hydroxyhex-1-enyl]-1,5-dimethylpyrazol-4-yl]-6-methyl-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate (PubChem CID 166022491) has the molecular formula C36H41N3O4 and a molecular weight of 579.74 g/mol. Its IUPAC name is ethyl 7-[3-[(E)-6-hydroxyhex-1-enyl]-1,5-dimethylpyrazol-4-yl]-6-methyl-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 7-[3-[(E)-6-hydroxyhex-1-enyl]-1,5-dimethylpyrazol-4-yl]-6-methyl-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 166022491 |
| Molecular Formula | C36H41N3O4 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | ethyl 7-[3-[(E)-6-hydroxyhex-1-enyl]-1,5-dimethylpyrazol-4-yl]-6-methyl-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c(/C=C/CCCCO)nn(C)c3C)c(C)ccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C36H41N3O4/c1-5-42-36(41)35-28(17-13-23-43-31-19-12-15-26-14-9-10-16-27(26)31)29-21-20-24(2)32(34(29)37-35)33-25(3)39(4)38-30(33)18-8-6-7-11-22-40/h8-10,12,14-16,18-21,37,40H,5-7,11,13,17,22-23H2,1-4H3/b18-8+ |
| InChIKey | HWXBQAIOJSHWBM-QGMBQPNBSA-N |
| XLogP | 7.70 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|