C36H40F2N4O5 — CID 175967992
ethyl 6-fluoro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-7-[3-[(1R)-1-hydroxy-3-morpholin-4-ylpropyl]-1,5-dimethylpyrazol-4-yl]-1H-indole-2-carboxylate (PubChem CID 175967992) has the molecular formula C36H40F2N4O5 and a molecular weight of 646.74 g/mol. Its IUPAC name is ethyl 6-fluoro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-7-[3-[(1R)-1-hydroxy-3-morpholin-4-ylpropyl]-1,5-dimethylpyrazol-4-yl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 6-fluoro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-7-[3-[(1R)-1-hydroxy-3-morpholin-4-ylpropyl]-1,5-dimethylpyrazol-4-yl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 175967992 |
| Molecular Formula | C36H40F2N4O5 |
| Molecular Weight | 646.74 g/mol |
| Exact Mass | 646.30 |
| IUPAC Name | ethyl 6-fluoro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-7-[3-[(1R)-1-hydroxy-3-morpholin-4-ylpropyl]-1,5-dimethylpyrazol-4-yl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c([C@H](O)CCN4CCOCC4)nn(C)c3C)c(F)ccc2c1CCCOc1cccc2cc(F)ccc12 |
| InChI | InChI=1S/C36H40F2N4O5/c1-4-46-36(44)34-26(8-6-18-47-30-9-5-7-23-21-24(37)10-11-25(23)30)27-12-13-28(38)32(33(27)39-34)31-22(2)41(3)40-35(31)29(43)14-15-42-16-19-45-20-17-42/h5,7,9-13,21,29,39,43H,4,6,8,14-20H2,1-3H3/t29-/m1/s1 |
| InChIKey | HTXRLEDOCVVWKA-GDLZYMKVSA-N |
| XLogP | 6.25 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.74 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|