C40H50ClN5O6S — CID 142591687
ethyl 7-[3-[1-[3-chloropropylsulfonyl(methyl)amino]-3-morpholin-4-ylpropyl]-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate (PubChem CID 142591687) has the molecular formula C40H50ClN5O6S and a molecular weight of 764.39 g/mol. Its IUPAC name is ethyl 7-[3-[1-[3-chloropropylsulfonyl(methyl)amino]-3-morpholin-4-ylpropyl]-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 7-[3-[1-[3-chloropropylsulfonyl(methyl)amino]-3-morpholin-4-ylpropyl]-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 142591687 |
| Molecular Formula | C40H50ClN5O6S |
| Molecular Weight | 764.39 g/mol |
| Exact Mass | 763.32 |
| IUPAC Name | ethyl 7-[3-[1-[3-chloropropylsulfonyl(methyl)amino]-3-morpholin-4-ylpropyl]-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c(C(CCN4CCOCC4)N(C)S(=O)(=O)CCCCl)nn(C)c3C)cccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C40H50ClN5O6S/c1-5-51-40(47)38-32(17-10-24-52-35-18-8-13-29-12-6-7-14-30(29)35)31-15-9-16-33(37(31)42-38)36-28(2)44(3)43-39(36)34(19-21-46-22-25-50-26-23-46)45(4)53(48,49)27-11-20-41/h6-9,12-16,18,34,42H,5,10-11,17,19-27H2,1-4H3 |
| InChIKey | NASGACUAHOBFHM-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.39 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|