C41H50ClN5O6S — CID 142591612
ethyl 7-[3-[[3-chloropropylsulfonyl-[3-(2-oxopyrrolidin-1-yl)propyl]amino]methyl]-5-ethyl-1-methylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate (PubChem CID 142591612) has the molecular formula C41H50ClN5O6S and a molecular weight of 776.40 g/mol. Its IUPAC name is ethyl 7-[3-[[3-chloropropylsulfonyl-[3-(2-oxopyrrolidin-1-yl)propyl]amino]methyl]-5-ethyl-1-methylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 7-[3-[[3-chloropropylsulfonyl-[3-(2-oxopyrrolidin-1-yl)propyl]amino]methyl]-5-ethyl-1-methylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 142591612 |
| Molecular Formula | C41H50ClN5O6S |
| Molecular Weight | 776.40 g/mol |
| Exact Mass | 775.32 |
| IUPAC Name | ethyl 7-[3-[[3-chloropropylsulfonyl-[3-(2-oxopyrrolidin-1-yl)propyl]amino]methyl]-5-ethyl-1-methylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c(CN(CCCN4CCCC4=O)S(=O)(=O)CCCCl)nn(C)c3CC)cccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C41H50ClN5O6S/c1-4-35-38(34(44-45(35)3)28-47(54(50,51)27-12-22-42)25-13-24-46-23-10-21-37(46)48)33-18-9-17-31-32(40(43-39(31)33)41(49)52-5-2)19-11-26-53-36-20-8-15-29-14-6-7-16-30(29)36/h6-9,14-18,20,43H,4-5,10-13,19,21-28H2,1-3H3 |
| InChIKey | AHNIHJHSPMXVCA-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.40 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|