C30H30ClN3O4 — CID 142591131
ethyl 6-chloro-7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate (PubChem CID 142591131) has the molecular formula C30H30ClN3O4 and a molecular weight of 532.04 g/mol. Its IUPAC name is ethyl 6-chloro-7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 6-chloro-7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 142591131 |
| Molecular Formula | C30H30ClN3O4 |
| Molecular Weight | 532.04 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | ethyl 6-chloro-7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c(CO)nn(C)c3C)c(Cl)ccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C30H30ClN3O4/c1-4-37-30(36)29-21(12-8-16-38-25-13-7-10-19-9-5-6-11-20(19)25)22-14-15-23(31)27(28(22)32-29)26-18(2)34(3)33-24(26)17-35/h5-7,9-11,13-15,32,35H,4,8,12,16-17H2,1-3H3 |
| InChIKey | CMTPBAZGXGDAOE-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.04 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|