C38H37BrClN3O4 — CID 142591407
ethyl 1-[[2-(bromomethyl)phenyl]methyl]-6-chloro-7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate (PubChem CID 142591407) has the molecular formula C38H37BrClN3O4 and a molecular weight of 715.09 g/mol. Its IUPAC name is ethyl 1-[[2-(bromomethyl)phenyl]methyl]-6-chloro-7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate.
| Compound Name | ethyl 1-[[2-(bromomethyl)phenyl]methyl]-6-chloro-7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 142591407 |
| Molecular Formula | C38H37BrClN3O4 |
| Molecular Weight | 715.09 g/mol |
| Exact Mass | 713.17 |
| IUPAC Name | ethyl 1-[[2-(bromomethyl)phenyl]methyl]-6-chloro-7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(CCCOc2cccc3ccccc23)c2ccc(Cl)c(-c3c(CO)nn(C)c3C)c2n1Cc1ccccc1CBr |
| InChI | InChI=1S/C38H37BrClN3O4/c1-4-46-38(45)37-29(16-10-20-47-33-17-9-14-25-11-7-8-15-28(25)33)30-18-19-31(40)35(34-24(2)42(3)41-32(34)23-44)36(30)43(37)22-27-13-6-5-12-26(27)21-39/h5-9,11-15,17-19,44H,4,10,16,20-23H2,1-3H3 |
| InChIKey | YBIHMXWMQZRUNN-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.09 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|