C34H37BrClFN4O3 — CID 142591230
ethyl 1-(4-aminobutyl)-7-[3-(bromomethyl)-1,5-dimethylpyrazol-4-yl]-6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]indole-2-carboxylate (PubChem CID 142591230) has the molecular formula C34H37BrClFN4O3 and a molecular weight of 684.05 g/mol. Its IUPAC name is ethyl 1-(4-aminobutyl)-7-[3-(bromomethyl)-1,5-dimethylpyrazol-4-yl]-6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]indole-2-carboxylate.
| Compound Name | ethyl 1-(4-aminobutyl)-7-[3-(bromomethyl)-1,5-dimethylpyrazol-4-yl]-6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]indole-2-carboxylate |
|---|---|
| PubChem CID | 142591230 |
| Molecular Formula | C34H37BrClFN4O3 |
| Molecular Weight | 684.05 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | ethyl 1-(4-aminobutyl)-7-[3-(bromomethyl)-1,5-dimethylpyrazol-4-yl]-6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(CCCOc2cccc3cc(F)ccc23)c2ccc(Cl)c(-c3c(CBr)nn(C)c3C)c2n1CCCCN |
| InChI | InChI=1S/C34H37BrClFN4O3/c1-4-43-34(42)33-25(10-8-18-44-29-11-7-9-22-19-23(37)12-13-24(22)29)26-14-15-27(36)31(32(26)41(33)17-6-5-16-38)30-21(2)40(3)39-28(30)20-35/h7,9,11-15,19H,4-6,8,10,16-18,20,38H2,1-3H3 |
| InChIKey | PKCYNHAJACZASB-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.05 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|